mirror of
https://github.com/pytorch/pytorch.git
synced 2025-10-21 13:44:15 +08:00
* [GanH][Easy]: Add assertion to adaptive weighting layer 0 weight causes numeric instability and exploding ne * [Easy] Add cast op before computing norm in diagnose options As LpNorm only takes floats we add a manual casting here. * Introduce a new caching device allocator `cudaMalloc` and `cudaFree` calls are slow, and become slower the more GPUs there are. Essentially, they grab a host-wide (not device-wide) lock because GPU memory is transparently shared across all GPUs. Normally, this isn't much of a concern since workloads allocate memory upfront, and reuse it during later computation. However, under some computation models (specifically, memory conserving approaches like checkpoint-and-recompute, see https://medium.com/@yaroslavvb/fitting-larger-networks-into-memory-583e3c758ff9) this assumption is no longer true. In these situations, `cudaMalloc` and `cudaFree` are common and frequent. Furthermore, in data parallel contexts, these calls happen at nearly the same time from all GPUs worsening lock contention. A common solution to this problem is to add a custom allocator. In fact, nVIDIA provides one out of the box: CUB, which Caffe2 already supports. Unfortunately, the CUB allocator suffers from very high fragmentation. This is primarily because it is a "buddy" allocator which neither splits nor merges free cached blocks. Study https://github.com/NVlabs/cub/blob/1.8.0/cub/util_allocator.cuh#L357 if you want to convince yourself. This diff adapts a caching allocator from the Torch codebase https://github.com/torch/cutorch/blob/master/lib/THC/THCCachingAllocator.cpp which does splitting and merging and ends up working really well, at least for workloads like the checkpoint-and-recompute computation models noted above. I simplified the implementation a little bit, made it a bit more C++-like. I also removed a bunch of stream synchronization primitives for this diff. I plan to add them back in subsequent diffs. * Report reader progress in fblearner workflows Integrate with fblearner progress reporting API and add support to report training progress from reader nodes. If reader is constructed with batch limits, report based on finished batch vs total batch. The finished batch may be more than total batch because we evaludate if we should stop processing everytime we dequeue a split. If no limit for the reader, report based on finished splits (Hive files) vs total splits. This is fairly accurate. * [GanH][Diagnose]: fix plotting 1. ganh diagnose needs to set plot options 2. modifier's blob name is used for metric field can need to be fixed before generating net * Automatic update of fbcode/onnx to 985af3f5a0f7e7d29bc0ee6b13047e7ead9c90c8 * Make CompositeReader stops as soon as one reader finishes Previously, CompositeReader calls all readers before stopping. It results in flaky test since the last batch may be read by different threads; resulting in dropped data. * [dper] make sure loss is not nan as desc. * [rosetta2] [mobile-vision] Option to export NHWC order for RoIWarp/RoIAlign Thanks for finding this @stzpz and @wangyanghan. Looks like NHWC is more optimized. For OCR though it doesn't yet help since NHWC uses more mem b/w but will soon become important. * Intra-op parallel FC operator Intra-op parallel FC operator * [C2 Proto] extra info in device option passing extra information in device option design doc: https://fb.quip.com/yAiuAXkRXZGx * Unregister MKL fallbacks for NCHW conversions * Tracing for more executors Modified Tracer to work with other executors and add more tracing * Remove ShiftActivationDevices() * Check for blob entry iff it is present When processing the placeholders ops, ignore if the blob is not present in the blob_to_device. * Internalize use of eigen tensor Move use of eigen tensor out of the header file so we don't get template partial specialization errors when building other libraries. * feature importance for transformed features. * - Fix unused parameter warnings The changes in this diff comments out unused parameters. This will allow us to enable -Wunused-parameter as error. #accept2ship * add opencv dependencies to caffe2 The video input op requires additional opencv packages. This is to add them to cmake so that it can build * Add clip_by_value option in gradient clipping Add clip_by_value option in gradient clipping when the value is bigger than max or smaller than min, do the clip * std::round compat
743 lines
27 KiB
Python
743 lines
27 KiB
Python
## @package net_builder
|
|
# Module caffe2.python.net_builder
|
|
from __future__ import absolute_import
|
|
from __future__ import division
|
|
from __future__ import print_function
|
|
from __future__ import unicode_literals
|
|
|
|
from caffe2.python import core, context
|
|
from caffe2.python.task import Task, TaskGroup
|
|
from caffe2.python.control_ops_util import add_if_op, add_while_op
|
|
|
|
|
|
@context.define_context()
|
|
class NetBuilder(object):
|
|
"""
|
|
Scope-driven mechanism for building nets, loops and conditional blocks.
|
|
Arguments:
|
|
name: NetBuilder's name
|
|
initial_scope: list of blobs that are available for reading/writing
|
|
Example:
|
|
from caffe2.python.net_builder import NetBuilder, ops
|
|
with NetBuilder() as nb:
|
|
c = ops.Const(5)
|
|
d = ops.Const(0)
|
|
with ops.loop():
|
|
ops.stop_if(ops.LE([c, ops.Const(0)]))
|
|
ops.Add([c, ops.Const(-1)], [c])
|
|
with ops.If(ops.GE([c, ops.Const(3)])):
|
|
ops.Add([d, ops.Const(10)], [d])
|
|
ops.Print(c, [])
|
|
ops.Print(d, [])
|
|
step = core.to_execution_step(nb)
|
|
"""
|
|
def __init__(self, name=None, initial_scope=None, _stop_blob_required=False,
|
|
_stop_blob=None, _fullname=None, _use_control_ops=False):
|
|
parent = NetBuilder.current(required=False)
|
|
assert not _fullname or not name, 'Cannot set both _fullname and name'
|
|
assert not _use_control_ops or \
|
|
(not _stop_blob_required and not _stop_blob), \
|
|
'Stop blobs are not used with control operators'
|
|
self.name = _fullname or '/'.join(
|
|
n for n in (parent.name if parent else None, name) if n
|
|
)
|
|
self._frozen = False
|
|
self._current_net = None
|
|
self._children = []
|
|
if parent:
|
|
# make sure parent has an up to date lexical scope computed
|
|
parent._update_lexical_scope()
|
|
self._init_lexical_scope = set(parent._lexical_scope) if parent else set()
|
|
if initial_scope:
|
|
self._init_lexical_scope |= set([str(b) for b in initial_scope])
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
self._stop_blob = _stop_blob
|
|
self._stop_blob_required = _stop_blob_required
|
|
self._use_control_ops = _use_control_ops
|
|
|
|
def stop_blob(self):
|
|
"""
|
|
Returns the BlobReference to the stop_blob of this NetBuilder.
|
|
If one is not yet available, creates one.
|
|
This function assumes that the stop_blob() will be used immediatelly
|
|
in the current net, so it doesn't initialize it if the current net is
|
|
the first of the builder.
|
|
"""
|
|
assert not self._use_control_ops, \
|
|
'Stop blobs are not used with control operators'
|
|
if self._stop_blob is None:
|
|
net = self.current_net()
|
|
self._stop_blob = core.BlobReference(
|
|
net.NextName('stop_blob'), net=net)
|
|
net.Const(False, blob_out=self._stop_blob)
|
|
if self._current_net != self._children[0]:
|
|
self._children.insert(0, core.Net('stop_blob_init'))
|
|
self._children[0].Const(False, blob_out=self._stop_blob)
|
|
return self._stop_blob
|
|
|
|
def stop_if(self, blob):
|
|
assert not self._use_control_ops, \
|
|
'Stop blobs are not used with control operators'
|
|
stop_blob = self.stop_blob()
|
|
ops.Or([stop_blob, blob], [stop_blob])
|
|
self._current_net = None
|
|
|
|
def _assert_mutable(self):
|
|
assert not self._frozen, (
|
|
'This NetBuilder (%s) has been built already.' % self.name)
|
|
|
|
def _update_lexical_scope(self):
|
|
"""
|
|
Updates lexical scope based on the current list of children.
|
|
Lexical scope contains names of blobs that are currently available
|
|
and were introduced in the net builder
|
|
"""
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
for child in self._children:
|
|
if isinstance(child, core.Net):
|
|
self._lexical_scope |= child.UsedBlobNames()
|
|
elif isinstance(child, NetBuilder) and child._use_control_ops:
|
|
self._lexical_scope |= child._lexical_scope
|
|
|
|
def _reset_children(self):
|
|
self._current_net = None
|
|
self._children = []
|
|
self._lexical_scope = set(self._init_lexical_scope)
|
|
|
|
def add(self, child):
|
|
self._assert_mutable()
|
|
|
|
if self._use_control_ops:
|
|
assert isinstance(child, core.Net) or (
|
|
isinstance(child, NetBuilder) and child._use_control_ops), \
|
|
"Expected Net or NetBuilder with control ops"
|
|
|
|
self._current_net = None
|
|
self._children.append(child)
|
|
# to-do : check it's not a dag net
|
|
if isinstance(child, core.Net):
|
|
self._current_net = child
|
|
self._update_lexical_scope()
|
|
return child
|
|
|
|
def current_net(self, name=None):
|
|
self._assert_mutable()
|
|
if self._current_net is None or name is not None:
|
|
self.add(core.Net(name))
|
|
return self._current_net
|
|
|
|
def freeze(self):
|
|
for child in self._children:
|
|
if hasattr(child, 'freeze'):
|
|
child.freeze()
|
|
self._current_net = None
|
|
self._frozen = True
|
|
|
|
def get(self):
|
|
self.freeze()
|
|
return self._children
|
|
|
|
def __exit__(self, etype, *args):
|
|
if self._use_control_ops and len(self._children) > 0:
|
|
_children = self._children
|
|
self._reset_children()
|
|
merged_net = NetBuilder.merge_nets(
|
|
_children, self._lexical_scope)
|
|
assert merged_net, "Expected a non-empty merge of children"
|
|
self._children = [merged_net]
|
|
|
|
self.freeze()
|
|
if etype is not None:
|
|
return
|
|
assert (not self._stop_blob_required) or self._stop_blob is not None, (
|
|
'This NetBuilder (%s) requires a stop condition ' % self.name +
|
|
'to be set with `stop` or `stop_if`')
|
|
|
|
@staticmethod
|
|
def merge_nets(nets_or_builders, outer_blob_names):
|
|
# Only nets or builders with control ops are allowed.
|
|
# Need to pay attention to external outputs, e.g.
|
|
# ...
|
|
# IfNet1 (cond_blob):
|
|
# (Net1)
|
|
# X = 1
|
|
# IfNet2 (...):
|
|
# X = X + 1
|
|
# ...
|
|
# In this example there're two children in then branch of IfNet1:
|
|
# a subnet Net1 that creates blob X and sets its value to one, and
|
|
# a net builder IfNet2 that (conditionally) increments X.
|
|
# From IfNet2's point of view X is an external input
|
|
# and output blob, it will be put into IfNet2 net's external_output.
|
|
# At the same time, from the point of view of IfNet1 X is purely local.
|
|
# Net.AppendNet just merges external outputs of the networks, so
|
|
# without checking this the result of Net1.AppendNet(IfNet2's net)
|
|
# would have blob X in external_output
|
|
|
|
net = None
|
|
for n in nets_or_builders:
|
|
cur = None
|
|
if isinstance(n, NetBuilder):
|
|
assert n._use_control_ops, \
|
|
"Merging of NetBuilder supported only for control ops"
|
|
nets = n.get()
|
|
assert len(nets) == 1 and isinstance(nets[0], core.Net), \
|
|
"Invalid control op net builder"
|
|
cur = nets[0]
|
|
else:
|
|
assert isinstance(n, core.Net)
|
|
cur = n
|
|
if net:
|
|
net.AppendNet(cur)
|
|
else:
|
|
net = cur
|
|
if net:
|
|
# correct external output
|
|
external_outputs = [o for o in net.Proto().external_output
|
|
if o in outer_blob_names]
|
|
net.Proto().external_output[:] = external_outputs
|
|
return net
|
|
|
|
def __str__(self):
|
|
return self.name or 'Un-named NetBuilder'
|
|
|
|
|
|
class Operations(object):
|
|
"""
|
|
Operations to be used in the context of a NetBuilder.
|
|
"""
|
|
def net(self, net=None, name=None):
|
|
"""
|
|
Retrieves the current net, or add a new net to the builder.
|
|
Args:
|
|
net: If provided, add the given net to the active builder.
|
|
Else, returns the current Net or creates a new one as needed.
|
|
name: if provided, creates a new Net with given name and makes
|
|
it the new current net of the active builder. Cannot
|
|
be provided if net is provided.
|
|
"""
|
|
assert name is None or net is None, (
|
|
'Cannot provide both `net` and `name`.')
|
|
if net is not None:
|
|
NetBuilder.current().add(net)
|
|
return net
|
|
return NetBuilder.current().current_net(name=name)
|
|
|
|
def __getattr__(self, op_type):
|
|
"""
|
|
Adds an operator call to the currently active Net.
|
|
"""
|
|
if op_type.startswith('__'):
|
|
raise AttributeError()
|
|
# We want hasattr to work properly even if no context is active.
|
|
if NetBuilder.current(required=False) is None:
|
|
raise AttributeError('No active NetBuilder.')
|
|
return getattr(self.net(), op_type)
|
|
|
|
def task_group(self):
|
|
"""
|
|
Creates a local task group which will execute as the next step of
|
|
the current NetBuilder.
|
|
"""
|
|
from caffe2.python import task
|
|
group = NetBuilder.current()
|
|
with task.Cluster():
|
|
with task.Node('local'):
|
|
tg = task.TaskGroup()
|
|
group.add(tg)
|
|
return tg
|
|
|
|
def stop(self):
|
|
"""
|
|
Stop execution of the current execution step.
|
|
Example:
|
|
ops.Print(a, 0)
|
|
ops.stop()
|
|
ops.Print(b, 0)
|
|
In the example, 'b' will never be printed.
|
|
"""
|
|
return self.stop_if(ops.Const(True))
|
|
|
|
def stop_if(self, blob):
|
|
"""
|
|
Stop execution of the current execution step if the
|
|
condition `blob` is met.
|
|
Example:
|
|
ops.Print(a, 0)
|
|
ops.stop_if(ops.LE([x, ops.Const(0)]))
|
|
ops.Print(b, 0)
|
|
In the example, 'b' will only be printed if the value of scalar
|
|
tensor 'x' is greater than 0.
|
|
"""
|
|
return NetBuilder.current().stop_if(blob)
|
|
|
|
def loop(self, iters=None, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute in a loop as the next step of
|
|
the current NetBuilder. If `iters` is provided, the loop will execute
|
|
for `iters` iterations and then stop. `iters` can be a constant or a
|
|
BlobReference. If `iters` is not provided, the loop will execute
|
|
until `ops.stop` or `ops.stop_if` is called.
|
|
Examples:
|
|
a = ops.Const(5)
|
|
with ops.loop():
|
|
ops.stop_if(ops.LE([a, ops.Const(0)]))
|
|
ops.Print(a, 0)
|
|
ops.Add([a, ops.Const(-1)], [a])
|
|
Above, 'a' will be printed 5 times, with values 5 to 1.
|
|
|
|
with ops.loop(10) as loop:
|
|
ops.LogInfo(loop.iter())
|
|
This will print the numbers from 0 to 9.
|
|
|
|
x = ops.Add([ops.Const(10), ops.Const(10)])
|
|
with ops.loop(x) as loop:
|
|
ops.LogInfo(loop.iter())
|
|
This will print the numbers from 0 to 19.
|
|
"""
|
|
return NetBuilder.current().add(_Loop(iters, name=name))
|
|
|
|
def stop_guard(self, has_stopped_blob=None, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute once as the next step of the
|
|
current NetBuilder. After execution, a bool tensor will indicate
|
|
whether the inner execution was halted with `stop` or `stop_if`.
|
|
Example:
|
|
a = ops.Const(True)
|
|
with ops.stop_guard() as sg1:
|
|
ops.stop_if(a)
|
|
ops.Print(ops.Const('did not stop'))
|
|
b = ops.Const(False)
|
|
with ops.stop_guard() as sg2:
|
|
ops.stop_if(b)
|
|
ops.Print(ops.Const('did not stop'))
|
|
ops.Print(sg1.has_stopped(), [])
|
|
ops.Print(sg2.has_stopped(), [])
|
|
In the example, 'did not stop' will be printed once,
|
|
followed by True and False.
|
|
"""
|
|
return NetBuilder.current().add(
|
|
_StopGuard(has_stopped_blob=has_stopped_blob, name=name))
|
|
|
|
def If(self, cond, name=None):
|
|
"""
|
|
Creates a NetBuilder that will execute once as the next step of the
|
|
current NetBuilder if the blob `cond` is True.
|
|
Example:
|
|
with ops.If(ops.Const(True)):
|
|
ops.Print(ops.Const('Will print'))
|
|
with ops.If(ops.Const(False)):
|
|
ops.Print(ops.Const('Wont print'))
|
|
The example will print 'Will print' once.
|
|
"""
|
|
return NetBuilder.current().add(_RunIf(cond, name=name))
|
|
|
|
def IfNet(self, cond, name=None):
|
|
"""
|
|
Same as If, but uses 'If' operator instead of execution step logic
|
|
"""
|
|
return NetBuilder.current().add(_RunIfNet(cond, name=name))
|
|
|
|
def Else(self, name=None):
|
|
"""
|
|
Else branch of IfNet, has to be specified immediately after IfNet.
|
|
Example:
|
|
with ops.IfNet(ops.LT([x, y])):
|
|
...
|
|
with ops.Else():
|
|
...
|
|
"""
|
|
return _RunElseNet(name=name)
|
|
|
|
def WhileNet(self, name=None):
|
|
"""
|
|
NetBuilder for 'While' control operator
|
|
"""
|
|
return NetBuilder.current().add(_RunWhileNet(name=name))
|
|
|
|
def Condition(self, name=None):
|
|
"""
|
|
Loop's condition, executed within WhileNet context
|
|
"""
|
|
assert isinstance(NetBuilder.current(), _RunWhileNet), \
|
|
"Use of Condition outside of WhileNet"
|
|
return _RunWhileCondition(name=name)
|
|
|
|
def task_init(self):
|
|
"""
|
|
Defines operations that will be executed once at task startup.
|
|
Useful when implementing processors, that don't have access to the Task
|
|
top-level structure.
|
|
|
|
This setup will be run only once, even if multiple instances of the task
|
|
will run in parallel. For instance-local initialization, use
|
|
`task_instance_init` instead.
|
|
|
|
Example:
|
|
def my_processor(rec):
|
|
with ops.task_init():
|
|
one = ops.Const(1)
|
|
two = ops.Const(1)
|
|
return Tuple(
|
|
ops.Add(rec[0](), zero), ops.Add(rec[1](), two))
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(Task.TASK_SETUP, setup)
|
|
return setup
|
|
|
|
def task_exit(self):
|
|
"""
|
|
Define operations to be executed once at task shutdown.
|
|
Useful when implementing processors, that don't have access to the Task
|
|
top-level structure.
|
|
|
|
This shutdown will be run only once, after all concurrent instances of
|
|
the task have already finished. For instance-local shutdown,
|
|
use `task_instance_exit` instead.
|
|
|
|
Example:
|
|
def read_queue(queue):
|
|
with ops.task_exit():
|
|
queue.close(ops.net())
|
|
return queue.read(ops.net())
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT)
|
|
self.net().add_attribute(Task.TASK_SETUP, setup)
|
|
return setup
|
|
|
|
def task_instance_init(self):
|
|
"""
|
|
Defines operations that will be executed once at startup of each
|
|
instance of a task. This can be seen as "thread_local" initialization.
|
|
It is guaranteed to run only after all `task_init` logic finishes.
|
|
|
|
This setup will be run concurrently for each instance of a task.
|
|
For global task initialization, use `task_init` instead.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(Task.TASK_INSTANCE_SETUP, setup)
|
|
return setup
|
|
|
|
def task_instance_exit(self):
|
|
"""
|
|
Defines operations that will be executed once at shutdown of each
|
|
instance of a task. This can be seen as "thread_local" finalization.
|
|
|
|
This shutdown will be run concurrently for each instance of a task.
|
|
For global task shutdown, use `task_exit` instead.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT)
|
|
self.net().add_attribute(Task.TASK_INSTANCE_SETUP, setup)
|
|
return setup
|
|
|
|
def local_init(self):
|
|
"""
|
|
Similar to `task_init`, but executes at TaskGroup's startup instead,
|
|
before any task of the group starts executing. This will run only
|
|
once on each node, before initialization of any task, so it can be
|
|
used e.g. to initialize blobs shared across tasks.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.INIT)
|
|
self.net().add_attribute(TaskGroup.LOCAL_SETUP, setup)
|
|
return setup
|
|
|
|
def local_exit(self, name=None):
|
|
"""
|
|
Similar to `task_exit`, but executes at TaskGroup's exit instead,
|
|
after all tasks of the group finished execution.
|
|
This will run only once on each node.
|
|
"""
|
|
setup = _SetupBuilder(_SetupBuilder.EXIT, name)
|
|
self.net().add_attribute(TaskGroup.LOCAL_SETUP, setup)
|
|
return setup
|
|
|
|
def task_reporter(self, interval_ms=1000, name=None):
|
|
"""
|
|
Define operations to be executed at every time interval from
|
|
task start-up to finish. These operations are guaranteed to
|
|
execute at least once after all other operations of the task are
|
|
finished.
|
|
|
|
Example:
|
|
with ops.task_reporter(interval_ms=10000):
|
|
ops.LogInfo('10s elapsed')
|
|
"""
|
|
return _ReporterBuilder(interval_ms, net=self.net(), name=name)
|
|
|
|
def local_reporter(self, interval_ms=1000, name=None):
|
|
"""
|
|
Similar to task_report, but operations defined within this block
|
|
will run repeatedly for as long as any of the tasks in the current
|
|
TaskGroup have not finished.
|
|
"""
|
|
return _ReporterBuilder(interval_ms, name=name)
|
|
|
|
|
|
ops = Operations()
|
|
|
|
|
|
class _ReporterBuilder(NetBuilder):
|
|
def __init__(self, interval_ms, net=None, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
self._net = net
|
|
self.interval_ms = interval_ms
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None:
|
|
step = core.to_execution_step(self)
|
|
step.RunEveryMillis(self.interval_ms)
|
|
if self._net:
|
|
self._net.add_attribute(Task.REPORT_STEP, step)
|
|
else:
|
|
TaskGroup.current().report_step(
|
|
step, interval_ms=self.interval_ms)
|
|
NetBuilder.__exit__(self, etype, *args)
|
|
|
|
|
|
class _SetupBuilder(NetBuilder):
|
|
INIT = 'init'
|
|
EXIT = 'exit'
|
|
|
|
def __init__(self, type, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
self.type = type
|
|
|
|
def setup(self, net):
|
|
if self.type == _SetupBuilder.INIT:
|
|
return core.to_execution_step(self)
|
|
|
|
def exit(self, net):
|
|
if self.type == _SetupBuilder.EXIT:
|
|
return core.to_execution_step(self)
|
|
|
|
|
|
class _RunOnce(NetBuilder):
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name)
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None and self._stop_blob is not None:
|
|
ops.stop()
|
|
NetBuilder.__exit__(self, etype, *args)
|
|
|
|
|
|
class _StopGuard(_RunOnce):
|
|
def __init__(self, has_stopped_blob=None, name=None):
|
|
_RunOnce.__init__(self, name)
|
|
self._stopped = has_stopped_blob
|
|
self._ran = False
|
|
|
|
def __enter__(self):
|
|
r = _RunOnce.__enter__(self)
|
|
self._stopped = ops.Const(True, blob_out=self._stopped)
|
|
return r
|
|
|
|
def __exit__(self, etype, *args):
|
|
if etype is None:
|
|
self._ran = True
|
|
ops.Const(False, blob_out=self._stopped)
|
|
_RunOnce.__exit__(self, etype, *args)
|
|
|
|
def has_stopped(self):
|
|
"""
|
|
Return a blob that will be set to scalar bool `True` after
|
|
this net builder ran, iff it was halted early.
|
|
"""
|
|
assert self._ran, 'Context not used yet.'
|
|
return self._stopped
|
|
|
|
|
|
class _Loop(NetBuilder):
|
|
def __init__(self, iters=None, name=None):
|
|
NetBuilder.__init__(self, name, _stop_blob_required=True)
|
|
if iters is not None:
|
|
self._inc = ops.Const(1)
|
|
self._iter = ops.Const(0)
|
|
self._num_iters = (
|
|
iters if isinstance(iters, core.BlobReference)
|
|
else ops.Const(iters))
|
|
else:
|
|
self._num_iters = None
|
|
|
|
def iter(self):
|
|
assert self._num_iters is not None, (
|
|
'This loop does not have a number of iterations.')
|
|
assert self._iter is not None, (
|
|
'iter() must be called from inside the loop context')
|
|
return self._iter
|
|
|
|
def __enter__(self):
|
|
builder = NetBuilder.__enter__(self)
|
|
if self._num_iters is not None:
|
|
ops.stop_if(ops.GE([self._iter, self._num_iters]))
|
|
return builder
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None and self._num_iters is not None:
|
|
self.current_net().Add([self._iter, self._inc], [self._iter])
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunIf(_RunOnce):
|
|
def __init__(self, cond_blob=None, name=None, _already_ran=None):
|
|
_RunOnce.__init__(self, name)
|
|
assert cond_blob or _already_ran
|
|
self._is_else = cond_blob is None
|
|
if _already_ran is None:
|
|
self._else_blob = ops.Not(cond_blob)
|
|
self._already_ran = ops.Const(False)
|
|
else:
|
|
self._already_ran = _already_ran
|
|
self._else_blob = _already_ran if cond_blob is None else (
|
|
ops.Or([_already_ran, ops.Not(cond_blob)]))
|
|
|
|
def __enter__(self):
|
|
r = _RunOnce.__enter__(self)
|
|
ops.stop_if(self._else_blob)
|
|
ops.Const(True, blob_out=self._already_ran)
|
|
return r
|
|
|
|
def Elif(self, cond, name=None):
|
|
assert not self._is_else, 'Else not allowed for an Else.'
|
|
return NetBuilder.current().add(_RunIf(
|
|
cond, name=name or self.name, _already_ran=self._already_ran))
|
|
|
|
def Else(self, name=None):
|
|
assert not self._is_else, 'Elif not allowed for an Else.'
|
|
return NetBuilder.current().add(
|
|
_RunIf(name=name or self.name, _already_ran=self._already_ran))
|
|
|
|
|
|
class _RunIfNet(NetBuilder):
|
|
"""
|
|
Generates a single net that uses If operator
|
|
"""
|
|
def __init__(self, cond_blob, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
assert cond_blob, 'Conditional blob is not specified for an If net'
|
|
self._cond_blob = cond_blob
|
|
self._then_net = None
|
|
self._else_net = None
|
|
|
|
def add(self, child):
|
|
return NetBuilder.add(self, child)
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
_then_nets = self._children
|
|
self._reset_children()
|
|
|
|
self._then_net = NetBuilder.merge_nets(
|
|
_then_nets, self._lexical_scope)
|
|
if not self._then_net:
|
|
self._then_net = core.Net('empty_then_net')
|
|
|
|
if_net = core.Net(self.name + '/if_net')
|
|
add_if_op(if_net, self._cond_blob, self._lexical_scope,
|
|
self._then_net, self._else_net)
|
|
|
|
self._current_net = if_net
|
|
self._children = [if_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunElseNet(NetBuilder):
|
|
"""
|
|
Else branch for _RunIfNet builder
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
parent = NetBuilder.current(required=False)
|
|
assert parent and len(parent._children) > 0 and \
|
|
isinstance(parent._children[-1], _RunIfNet), \
|
|
'Invalid use of Else builder'
|
|
self._if_builder = parent._children[-1]
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
_else_nets = self._children
|
|
self._reset_children()
|
|
|
|
self._if_builder._else_net = NetBuilder.merge_nets(
|
|
_else_nets, self._lexical_scope)
|
|
if self._if_builder._else_net:
|
|
if_else_net = core.Net(self.name + '/if_else_net')
|
|
add_if_op(
|
|
if_else_net,
|
|
self._if_builder._cond_blob,
|
|
self._lexical_scope,
|
|
self._if_builder._then_net,
|
|
self._if_builder._else_net)
|
|
self._if_builder._current_net = if_else_net
|
|
self._if_builder._children = [if_else_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunWhileNet(NetBuilder):
|
|
"""
|
|
Generates a single net that uses While operator
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
self._cond_builder = None
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
assert self._cond_builder, \
|
|
'Condition builder must be specified in While op'
|
|
|
|
_cond_blob = self._cond_builder._cond_blob
|
|
_cond_net = self._cond_builder._cond_net
|
|
|
|
loop_body = self._children
|
|
self._reset_children()
|
|
loop_body_net = NetBuilder.merge_nets(
|
|
loop_body, self._lexical_scope)
|
|
if not loop_body_net:
|
|
loop_body_net = core.Net('empty_loop_body_net')
|
|
|
|
while_net = core.Net(self.name + '/while_net')
|
|
add_while_op(while_net, _cond_blob, self._lexical_scope,
|
|
loop_body_net, _cond_net)
|
|
|
|
self._current_net = while_net
|
|
self._children = [while_net]
|
|
NetBuilder.__exit__(self, type, *args)
|
|
|
|
|
|
class _RunWhileCondition(NetBuilder):
|
|
"""
|
|
Computes loop's condition, used in the context of WhileNet.
|
|
Last operator must have a single scalar boolean output that will be used
|
|
as a condition value, no other blobs created in the condition net are
|
|
visible outside of it
|
|
"""
|
|
def __init__(self, name=None):
|
|
NetBuilder.__init__(self, name=name, _use_control_ops=True)
|
|
parent = NetBuilder.current(required=False)
|
|
assert parent and isinstance(parent, _RunWhileNet), \
|
|
'Invalid use of loop condition builder'
|
|
assert not parent._cond_builder, \
|
|
'Multiple loop condition builders specified'
|
|
assert len(parent._children) == 0, \
|
|
'Condition definition must be specified before the loop\'s body'
|
|
parent._cond_builder = self
|
|
self._cond_blob = None
|
|
self._cond_net = None
|
|
|
|
def __exit__(self, type, *args):
|
|
if type is None:
|
|
condition_body = self._children
|
|
self._reset_children()
|
|
self._cond_net = NetBuilder.merge_nets(
|
|
condition_body, self._lexical_scope)
|
|
assert self._cond_net, 'Invalid loop condition specified'
|
|
assert len(self._cond_net.Proto().op) > 0, 'Invalid condition net'
|
|
last_op = self._cond_net.Proto().op[-1]
|
|
assert len(last_op.output) == 1, 'Invalid condition net'
|
|
self._cond_blob = core.BlobReference(name=last_op.output[0], net=None)
|
|
|
|
self._current_net = self._cond_net
|
|
self._children = [self._cond_net]
|
|
NetBuilder.__exit__(self, type, *args)
|